Systematic / IUPAC Name:
ID: Reference8294
Other Names:
Formula: C47H71NO12
Class: Natural Toxins
Azaspiracid-6 mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion with FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1285 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 11/5/2018 8:29:02 AM |
| InChI | InChI=1S/C47H71NO12/c1-26-17-33(10-8-9-11-39(49)50)54-43(21-26)14-15-47(60-43)32(7)19-34-35(57-47)20-37(53-34)42(51)46(52)13-12-29(4)40(59-46)30(5)23-44-22-27(2)18-36(55-44)41-38(56-44)24-45(58-41)31(6)16-28(3)25-48-45/h8,10,17,27-29,31-38,40-42,48,51-52H,5,9,11-16,18-25H2,1-4,6-7H3,(H,49,50)/b10-8+/t27-,28+,29-,31-,32+,33+,34+,35?,36+,37-,38+,40-,41+,42+,43+,44-,45-,46+,47+/m0/s1 |
| InChI Key | NQIYMIINGTZTOC-MFHCLEFTSA-N |
| Canonical SMILES | OC(=O)CC/C=C/[C@@H]1C=C(C[C@@]2(O1)CC[C@@]1(O2)[C@@H](C[C@@H]2C(O1)C[C@H](O2)[C@H]([C@@]1(O[C@@H]([C@H](CC1)C)C(=C)C[C@@]12C[C@@H](C)C[C@@H](O1)[C@H]1O[C@@]3(NC[C@H](C)C[C@@H]3C)C[C@H]1O2)O)O)C)C |
| CAS | |
| Splash | |
| Other Names |
| Wikipedia | Azaspiracid |