Systematic / IUPAC Name: 1-(2-Chlorophenyl)-2-(ethylamino)-1-propanone
ID: Reference8353
Other Names: 2-CEC
Formula: C11H14ClNO
Class: Drugs of Abuse/Illegal Drugs Sports Doping Drugs
2-Chloroethcathinone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 110 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/20/2018 12:36:55 PM |
| InChI | InChI=1S/C11H14ClNO/c1-3-13-8(2)11(14)9-6-4-5-7-10(9)12/h4-8,13H,3H2,1-2H3 |
| InChI Key | SSLLMDUMCHGPJN-UHFFFAOYSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names | 2-CEC |