Systematic / IUPAC Name: 1,1-Dimethylpyrrolidin-1-ium-2-carboxylic acid
ID: Reference837
Other Names: Pyrrolidinium, 2-carboxy-1,1-dimethyl-
Formula: C7H14NO2 +
Class: Endogenous Metabolites
DL-Stachydrine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 1 |
| No. of Spectra | 87 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/16/2015 10:45:01 AM |
| InChI | InChI=1S/C7H13NO2/c1-8(2)5-3-4-6(8)7(9)10/h6H,3-5H2,1-2H3/p+1 |
| InChI Key | CMUNUTVVOOHQPW-UHFFFAOYSA-O |
| Canonical SMILES | C[N+]1(CCCC1C(=O)O)C |
| CAS | 4136372 |
| Splash | |
| Other Names | Pyrrolidinium, 2-carboxy-1,1-dimethyl- |