Systematic / IUPAC Name: 3-{4-(Methoxycarbonyl)-4-[phenyl(propionyl)amino]-1-piperidinyl}propanoic acid
ID: Reference8371
Other Names:
1-Piperidinepropanoic acid, 4-(methoxycarbonyl)-4-((1-oxopropyl)phenylamino)-;
3-[4-Methoxycarbonyl-4-(N-propanoylanilino)piperidin-1-yl]propanoic acid;
4-Methoxycarbonyl-4-((1-oxopropyl)phenylamino)-1-piperidine propionic acid
Formula: C19H26N2O5
Class: Therapeutics/Prescription Drugs Drugs of Abuse/Illegal Drugs Sports Doping Drugs
Remifentanil acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 220 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/3/2018 8:57:44 AM |
| InChI | InChI=1S/C19H26N2O5/c1-3-16(22)21(15-7-5-4-6-8-15)19(18(25)26-2)10-13-20(14-11-19)12-9-17(23)24/h4-8H,3,9-14H2,1-2H3,(H,23,24) |
| InChI Key | GFJKFSFFMHOISI-UHFFFAOYSA-N |
| Canonical SMILES | CCC(=O)N(C1=CC=CC=C1)C2(CCN(CC2)CCC(=O)O)C(=O)OC |
| CAS | |
| Splash | |
| Other Names |
1-Piperidinepropanoic acid, 4-(methoxycarbonyl)-4-((1-oxopropyl)phenylamino)-; 3-[4-Methoxycarbonyl-4-(N-propanoylanilino)piperidin-1-yl]propanoic acid; 4-Methoxycarbonyl-4-((1-oxopropyl)phenylamino)-1-piperidine propionic acid |
| ChEMBL | CHEMBL1001 |
| ChemIDPlus | 132875684 |
| PubChem | 131560 |
| ChemSpider | 116266 |
| Cayman | 21926 |