Systematic / IUPAC Name: 7-Nitro-5-phenyl-1,3-dihydro-2H-1,4-benzodiazepin-2-one
ID: Reference838
Other Names:
Nitrazadon;
N-Desmethylnimetazepam;
1,3-Dihydro-7-nitro-5-phenyl-2H-1,4-benzodiazepin-2-one;
2H-1,4-Benzodiazepin-2-one, 1,3-dihydro-7-nitro-5-phenyl-;
7-Nitro-5-phenyl-2,3-dihydro-1H-1,4-benzodiazepin-2-one
; more
Formula: C15H11N3O3
Class: Therapeutics/Prescription Drugs Drugs of Abuse/Illegal Drugs
Nitrazepam mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap; Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 6 |
| No. of Spectra | 481 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/3/2016 10:48:39 AM |
| InChI | InChI=1S/C15H11N3O3/c19-14-9-16-15(10-4-2-1-3-5-10)12-8-11(18(20)21)6-7-13(12)17-14/h1-8H,9H2,(H,17,19) |
| InChI Key | KJONHKAYOJNZEC-UHFFFAOYSA-N |
| Canonical SMILES | C1C(=O)NC2=C(C=C(C=C2)[N+](=O)[O-])C(=N1)C3=CC=CC=C3 |
| CAS | 146225 |
| Splash | |
| Other Names |
Nitrazadon; N-Desmethylnimetazepam; 1,3-Dihydro-7-nitro-5-phenyl-2H-1,4-benzodiazepin-2-one; 2H-1,4-Benzodiazepin-2-one, 1,3-dihydro-7-nitro-5-phenyl-; 7-Nitro-5-phenyl-2,3-dihydro-1H-1,4-benzodiazepin-2-one; 2,3-Dihydro-7-nitro-5-phenyl-1H-1,4-benzodiazepin-2-on; 7-Nitro-5-phenyl-1,3-dihydro-benzo[E][1,4]diazepin-2-one; Benzalin; Mogadon; Remnos; Nitrados; Imeson; Epibenzalin; Neuchlonic; Apodorm; Calsmin; Dumolid; Epinelbon; Eunoctin; Imesont; Neozepam; Nitrenpax; Radedorm; Sonebon; Trazenin; Cerson; Hipnax; Hipsal; Nelmat; Surem; Dormo-puren; Persopit; Somitran; Sonnolin; Unisomnia; Alodorm; Gerson; Ibrovek; Mitidin; Nelbon; Pacisyn; Paxisyn; Pelson; Relact; Somnite; Eatan; Eatan N-; Dormin-5; Calsamin; Magadon; Megadon; Mogadan; Mogadone; Nitrempax; Eunoktin; Ipersed; Nitravet; Noctesed; Somnased; Somnibel; Ormodon; Paxadorm; Insoma; Arem |
| Wikipedia | Nitrazepam |
| HMDb | HMDB15534 |
| ChEBI | CHEBI:7581 |
| ChemSpider | 4350 |
| ChEMBL | CHEMBL13209 |
| KEGG | D00531; C07487 |
| PubChem | 4506 |
| ChemIDPlus | 000146225 |