Systematic / IUPAC Name: 1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-Pentadecafluoroheptane-1-sulfonic acid
ID: Reference8386
Other Names:
1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-Pentadecafluoroheptane-1-sulphonic acid;
1-Heptanesulfonic acid,1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoro-;
Pentadecafluoro-1-heptanesulfonic acid;
Perfluoroheptanesulfonic acid;
PFHpS
Formula: C7HF15O3S
Class: Extractables/Leachables Perfluorinated Hydrocarbons
Perfluoro-1-heptanesulfonate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion with FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 190 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 11/28/2018 9:17:11 AM |
| InChI | InChI=1S/C7HF15O3S/c8-1(9,2(10,11)4(14,15)6(18,19)20)3(12,13)5(16,17)7(21,22)26(23,24)25/h(H,23,24,25) |
| InChI Key | OYGQVDSRYXATEL-UHFFFAOYSA-N |
| Canonical SMILES | C(C(C(C(F)(F)F)(F)F)(F)F)(C(C(C(F)(F)S(=O)(=O)O)(F)F)(F)F)(F)F |
| CAS | |
| Splash | |
| Other Names |
1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-Pentadecafluoroheptane-1-sulphonic acid; 1-Heptanesulfonic acid,1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoro-; Pentadecafluoro-1-heptanesulfonic acid; Perfluoroheptanesulfonic acid; PFHpS |