Systematic / IUPAC Name: 1-(5-Hydroxypentyl)-N-(naphthalen-1-yl)-1H-indazole-3-carboxamide
ID: Reference8401
Other Names:
Formula: C23H23N3O2
Class: Drugs of Abuse/Illegal Drugs Sports Doping Drugs
MN-18 N-(5-hydroxypentyl) metabolite mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 193 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 11/30/2018 1:37:08 PM |
| InChI | InChI=1S/C23H23N3O2/c27-16-7-1-6-15-26-21-14-5-4-12-19(21)22(25-26)23(28)24-20-13-8-10-17-9-2-3-11-18(17)20/h2-5,8-14,27H,1,6-7,15-16H2,(H,24,28) |
| InChI Key | WKUSKPBWWGSRLA-UHFFFAOYSA-N |
| Canonical SMILES | O=C(NC1=C(C=CC=C2)C2=CC=C1)C3=NN(CCCCCO)C4=C3C=CC=C4 |
| CAS | |
| Splash | |
| Other Names |
| Cayman | 17786 |