Systematic / IUPAC Name: [1-(cyclohexylmethyl)-1H-indol-3-yl](4-methyl-1-naphthalenyl)-methanone
ID: Reference8411
Other Names:
Formula: C27H27NO
Class: Drugs of Abuse/Illegal Drugs Sports Doping Drugs
CHM-122 mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Plus Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 110 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/5/2018 12:54:15 PM |
| InChI | InChI=1S/C27H27NO/c1-19-15-16-24(22-12-6-5-11-21(19)22)27(29)25-18-28(17-20-9-3-2-4-10-20)26-14-8-7-13-23(25)26/h5-8,11-16,18,20H,2-4,9-10,17H2,1H3 |
| InChI Key | LRHHYHXSAWSXNA-UHFFFAOYSA-N |
| Canonical SMILES | CC1=C(C=CC=C2)C2=C(C(C3=CN(CC4CCCCC4)C5=C3C=CC=C5)=O)C=C1 |
| CAS | 1373876299 |
| Splash | |
| Other Names |
| Cayman | 22043 |