Systematic / IUPAC Name: Methyl 2-methyl-6-thiophen-2-ylpyridine-3-carboxylate
ID: Reference8431
Other Names:
Methyl 2-methyl-6-(thiophen-2-yl)nicotinate;
Methyl 2-methyl-6-thiophen-2-ylpyridine-3-carboxylate
Formula: C12H11NO2S
Methyl 2-methyl-6-(2-thienyl)nicotinate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 110 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/11/2018 8:34:44 AM |
| InChI | InChI=1S/C12H11NO2S/c1-8-9(12(14)15-2)5-6-10(13-8)11-4-3-7-16-11/h3-7H,1-2H3 |
| InChI Key | PXOOFKKNKVAIPU-UHFFFAOYSA-N |
| Canonical SMILES | CC1=C(C=CC(=N1)C2=CC=CS2)C(=O)OC |
| CAS | |
| Splash | |
| Other Names |
Methyl 2-methyl-6-(thiophen-2-yl)nicotinate; Methyl 2-methyl-6-thiophen-2-ylpyridine-3-carboxylate |