Systematic / IUPAC Name: N'-Hydroxy-4-pentylbenzenecarboximidamide
ID: Reference8436
Other Names: Benzenecarboximidamide, N'-hydroxy-4-pentyl-
Formula: C12H18N2O
N'-Hydroxy-4-pentylbenzenecarboximidamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 110 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/11/2018 8:46:15 AM |
| InChI | InChI=1S/C12H18N2O/c1-2-3-4-5-10-6-8-11(9-7-10)12(13)14-15/h6-9,15H,2-5H2,1H3,(H2,13,14) |
| InChI Key | PZSFSFDZODAZMT-UHFFFAOYSA-N |
| Canonical SMILES | CCCCCC1=CC=C(C=C1)C(=NO)N |
| CAS | |
| Splash | |
| Other Names | Benzenecarboximidamide, N'-hydroxy-4-pentyl- |