Systematic / IUPAC Name: 3-(4-Chloro-3-methylphenyl)-6,7-dihydro-5H-[1,3]thiazolo[3,2-a]pyrimidine
ID: Reference8447
Other Names: 5H-Thiazolo[3,2-a]pyrimidine, 3-(4-chloro-3-methylphenyl)-6,7-dihydro-
Formula: C13H13ClN2S
3-(4-Chloro-3-methylphenyl)-6,7-dihydro-5H-[1,3]thiazolo[3,2-a]pyrimidine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 109 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/11/2018 11:45:33 AM |
| InChI | InChI=1S/C13H13ClN2S/c1-9-7-10(3-4-11(9)14)12-8-17-13-15-5-2-6-16(12)13/h3-4,7-8H,2,5-6H2,1H3 |
| InChI Key | LNUBLOAILAWYIJ-UHFFFAOYSA-N |
| Canonical SMILES | CC1=C(C=CC(=C1)C2=CSC3=NCCCN23)Cl |
| CAS | |
| Splash | |
| Other Names | 5H-Thiazolo[3,2-a]pyrimidine, 3-(4-chloro-3-methylphenyl)-6,7-dihydro- |