Systematic / IUPAC Name: 6-(4-Chlorophenoxy)-3-pyridinecarbothioamide
ID: Reference8456
Other Names: 3-Pyridinecarbothioamide,6-(4-chlorophenoxy)-
Formula: C12H9ClN2OS
6-(4-Chlorophenoxy)pyridine-3-carbothioamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 220 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 12/12/2018 9:13:11 AM |
| InChI | InChI=1S/C12H9ClN2OS/c13-9-2-4-10(5-3-9)16-11-6-1-8(7-15-11)12(14)17/h1-7H,(H2,14,17) |
| InChI Key | CGDMQQUHBPAYBT-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC(=CC=C1OC2=NC=C(C=C2)C(=S)N)Cl |
| CAS | |
| Splash | |
| Other Names | 3-Pyridinecarbothioamide,6-(4-chlorophenoxy)- |