Systematic / IUPAC Name: 1-(4-Hydroxypentyl)indole-3-carboxylic acid
ID: Reference8466
Other Names: 1-(4-Hydroxypentyl)-1H-indole-3-carboxylic acid
Formula: C14H17NO3
Class: Drugs of Abuse/Illegal Drugs Sports Doping Drugs
PB-22 N-(4-Hydroxypentyl)-3-carboxyindole metabolite mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion with FAIMS |
| No. of Spectral Trees | 2 |
| No. of Spectra | 1401 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/8/2019 9:10:59 AM |
| InChI | InChI=1S/C14H17NO3/c1-10(16)5-4-8-15-9-12(14(17)18)11-6-2-3-7-13(11)15/h2-3,6-7,9-10,16H,4-5,8H2,1H3,(H,17,18) |
| InChI Key | JKTRSAHBYMWKAA-UHFFFAOYSA-N |
| Canonical SMILES | CC(CCCN1C=C(C2=CC=CC=C21)C(=O)O)O |
| CAS | |
| Splash | |
| Other Names | 1-(4-Hydroxypentyl)-1H-indole-3-carboxylic acid |