Systematic / IUPAC Name: Methyl (2Z)-3-(methylamino)-2-[4-(trifluoromethyl)benzoyl]-2-butenoate
ID: Reference8492
Other Names:
Formula: C14H14F3NO3
Methyl 3-(methylamino)-2-[4-(trifluoromethyl)benzoyl]but-2-enoate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 218 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 1/4/2019 8:43:53 AM |
| InChI | InChI=1S/C14H14F3NO3/c1-8(18-2)11(13(20)21-3)12(19)9-4-6-10(7-5-9)14(15,16)17/h4-7,18H,1-3H3/b11-8- |
| InChI Key | RAFSTDVDSMGOOM-FLIBITNWSA-N |
| Canonical SMILES | CC(=C(C(=O)C1=CC=C(C=C1)C(F)(F)F)C(=O)OC)NC |
| CAS | |
| Splash | |
| Other Names |
| PubChem | 5785732 |