Systematic / IUPAC Name: 1-(4-Carboxybutyl)indole-3-carboxylic acid
ID: Reference8493
Other Names: 3-Carboxy-1H-indole-1-pentanoic acid
Formula: C14H15NO4
Class: Drugs of Abuse/Illegal Drugs Sports Doping Drugs
PB-22 N-pentanoic acid-3-carboxyindole metabolite mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion with FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 310 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 1/16/2019 8:22:00 AM |
| InChI | InChI=1S/C14H15NO4/c16-13(17)7-3-4-8-15-9-11(14(18)19)10-5-1-2-6-12(10)15/h1-2,5-6,9H,3-4,7-8H2,(H,16,17)(H,18,19) |
| InChI Key | VCBRLAVKGLDFSD-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C2C(=C1)C(=CN2CCCCC(=O)O)C(=O)O |
| CAS | 1630022955 |
| Splash | |
| Other Names | 3-Carboxy-1H-indole-1-pentanoic acid |