Systematic / IUPAC Name: 3-(1-(Piperidin-1-yl)cyclohexyl)phenol
ID: Reference8495
Other Names: 3-hydroxy-PCP
Formula: C17H25NO
3-(1-(Piperidin-1-yl)cyclohexyl)phenol mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 133 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/13/2019 10:04:13 AM |
| InChI | InChI=1S/C17H25NO/c19-16-9-7-8-15(14-16)17(10-3-1-4-11-17)18-12-5-2-6-13-18/h7-9,14,19H,1-6,10-13H2 |
| InChI Key | AMSXTZUCNOKUEN-UHFFFAOYSA-N |
| Canonical SMILES | c1cc(cc(c1)O)C1(N2CCCCC2)CCCCC1 |
| CAS | |
| Splash | |
| Other Names | 3-hydroxy-PCP |