Systematic / IUPAC Name: 5-(4-Chlorophenyl)-2-(4-fluorophenyl)pyrazol-3-amine
ID: Reference8525
Other Names:
Formula: C15H11ClFN3
3-(4-Chlorophenyl)-1-(4-fluorophenyl)-1H-pyrazol-5-amine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 203 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/27/2019 10:43:32 AM |
| InChI | InChI=1S/C15H11ClFN3/c16-11-3-1-10(2-4-11)14-9-15(18)20(19-14)13-7-5-12(17)6-8-13/h1-9H,18H2 |
| InChI Key | LTSQSXLNOUAASC-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC(=CC=C1C2=NN(C(=C2)N)C3=CC=C(C=C3)F)Cl |
| CAS | 618098138 |
| Splash | |
| Other Names |