Systematic / IUPAC Name: 5-(4-Chlorophenyl)-3-[2-[(2,4,6-trimethylphenyl)methylsulfanyl]ethylamino]cyclohex-2-en-1-one
ID: Reference8529
Other Names: 2-Cyclohexen-1-one, 5-(4-chlorophenyl)-3-[[2-[[(2,4,6-trimethylphenyl)methyl]thio]ethyl]amino]-
Formula: C24H28ClNOS
5-(4-Chlorophenyl)-3-({2-[(mesitylmethyl)thio]ethyl}amino)cyclohex-2-en-1-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 218 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/27/2019 11:02:40 AM |
| InChI | InChI=1S/C24H28ClNOS/c1-16-10-17(2)24(18(3)11-16)15-28-9-8-26-22-12-20(13-23(27)14-22)19-4-6-21(25)7-5-19/h4-7,10-11,14,20,26H,8-9,12-13,15H2,1-3H3 |
| InChI Key | DESNHBYPHFEAMV-UHFFFAOYSA-N |
| Canonical SMILES | CC1=CC(=C(C(=C1)C)CSCCNC2=CC(=O)CC(C2)C3=CC=C(C=C3)Cl)C |
| CAS | |
| Splash | |
| Other Names | 2-Cyclohexen-1-one, 5-(4-chlorophenyl)-3-[[2-[[(2,4,6-trimethylphenyl)methyl]thio]ethyl]amino]- |