Systematic / IUPAC Name: N-(1-Benzylpiperidin-4-yl)-2-(2-methoxyphenyl)acetamide
ID: Reference8560
Other Names: Benzeneacetamide, 2-methoxy-N-[1-(phenylmethyl)-4-piperidinyl]-
Formula: C21H26N2O2
N1-(1-Benzyl-4-piperidyl)-2-(2-methoxyphenyl)acetamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 110 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/27/2019 1:06:58 PM |
| InChI | InChI=1S/C21H26N2O2/c1-25-20-10-6-5-9-18(20)15-21(24)22-19-11-13-23(14-12-19)16-17-7-3-2-4-8-17/h2-10,19H,11-16H2,1H3,(H,22,24) |
| InChI Key | FSSMCNONYPJAGO-UHFFFAOYSA-N |
| Canonical SMILES | COC1=CC=CC=C1CC(=O)NC2CCN(CC2)CC3=CC=CC=C3 |
| CAS | |
| Splash | |
| Other Names | Benzeneacetamide, 2-methoxy-N-[1-(phenylmethyl)-4-piperidinyl]- |
| ChemSpider | 2011489 |
| PubChem | 2729533 |
| ChEMBL | CHEMBL312631 |