Systematic / IUPAC Name: 3,5-Dichloro-N-[4-[(3-methoxypyrazin-2-yl)sulfamoyl]phenyl]benzamide
ID: Reference8561
Other Names: Benzamide, 3,5-dichloro-N-[4-[[(3-methoxy-2-pyrazinyl)amino]sulfonyl]phenyl]-
Formula: C18H14Cl2N4O4S
N1-(4-{[(3-Methoxypyrazin-2-yl)amino]sulfonyl}phenyl)-3,5-dichlorobenzamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 109 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 2/27/2019 1:08:34 PM |
| InChI | InChI=1S/C18H14Cl2N4O4S/c1-28-18-16(21-6-7-22-18)24-29(26,27)15-4-2-14(3-5-15)23-17(25)11-8-12(19)10-13(20)9-11/h2-10H,1H3,(H,21,24)(H,23,25) |
| InChI Key | QRZMFQYXXMTUIC-UHFFFAOYSA-N |
| Canonical SMILES | COC1=NC=CN=C1NS(=O)(=O)C2=CC=C(C=C2)NC(=O)C3=CC(=CC(=C3)Cl)Cl |
| CAS | |
| Splash | |
| Other Names | Benzamide, 3,5-dichloro-N-[4-[[(3-methoxy-2-pyrazinyl)amino]sulfonyl]phenyl]- |