Systematic / IUPAC Name: Methyl N'-(4-chlorophenyl)-N,N-dimethylcarbamimidothioate
ID: Reference8579
Other Names:
Formula: C10H13ClN2S
Methyl N-(4-chlorophenyl)-(dimethylamino)methanimidothioate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 110 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/4/2019 1:42:11 PM |
| InChI | InChI=1S/C10H13ClN2S/c1-13(2)10(14-3)12-9-6-4-8(11)5-7-9/h4-7H,1-3H3 |
| InChI Key | OWYIYYHCFABRSL-UHFFFAOYSA-N |
| Canonical SMILES | CN(C)C(=NC1=CC=C(C=C1)Cl)SC |
| CAS | |
| Splash | |
| Other Names |
| PubChem | 2725551 |