Systematic / IUPAC Name: 3-(Benzylamino)-3-methylsulfanyl-1-thiophen-2-ylprop-2-en-1-one
ID: Reference8601
Other Names: 2-Propen-1-one, 3-(methylthio)-3-[(phenylmethyl)amino]-1-(2-thienyl)-
Formula: C15H15NOS2
3-(Benzylamino)-3-(methylsulfanyl)-1-(2-thienyl)-2-propen-1-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 110 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/5/2019 1:35:38 PM |
| InChI | InChI=1S/C15H15NOS2/c1-18-15(10-13(17)14-8-5-9-19-14)16-11-12-6-3-2-4-7-12/h2-10,16H,11H2,1H3 |
| InChI Key | UQEBTTYOEXSBMI-UHFFFAOYSA-N |
| Canonical SMILES | CSC(=CC(=O)C1=CC=CS1)NCC2=CC=CC=C2 |
| CAS | |
| Splash | |
| Other Names | 2-Propen-1-one, 3-(methylthio)-3-[(phenylmethyl)amino]-1-(2-thienyl)- |