Systematic / IUPAC Name: Ethyl (2E)-(3-acetoxy-2(1H)-pyridinylidene)(cyano)acetate
ID: Reference8619
Other Names: Ethyl (2E)-2-(3-acetyloxy-1H-pyridin-2-ylidene)-2-cyanoacetate
Formula: C12H12N2O4
Ethyl 2-[3-(acetyloxy)-1,2-dihydropyridin-2-yliden]-2-cyanoacetate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 110 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/6/2019 8:12:57 AM |
| InChI | InChI=1S/C12H12N2O4/c1-3-17-12(16)9(7-13)11-10(18-8(2)15)5-4-6-14-11/h4-6,14H,3H2,1-2H3/b11-9+ |
| InChI Key | UCXXBHVCJSSCAR-PKNBQFBNSA-N |
| Canonical SMILES | CCOC(=O)C(=C1C(=CC=CN1)OC(=O)C)C#N |
| CAS | |
| Splash | |
| Other Names | Ethyl (2E)-2-(3-acetyloxy-1H-pyridin-2-ylidene)-2-cyanoacetate |
| PubChem | 5879487 |