Systematic / IUPAC Name: 5-{2-Ethoxy-5-[(4-ethyl-3-oxo-1-piperazinyl)acetyl]phenyl}-1-methyl-3-propyl-1,6-dihydro-7H-pyrazolo[4,3-d]pyrimidin-7-one
ID: Reference862
Other Names: 7H-Pyrazolo[4,3-d]pyrimidin-7-one, 5-{2-ethoxy-5-[2-(4-ethyl-3-oxo-1-piperazinyl)acetyl]phenyl}-1,6-dihydro-1-methyl-3-propyl-
Formula: C25H32N6O4
Class: Endogenous Metabolites Natural Products/Medicines
Oxohongdenafil mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 75 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 10/13/2016 11:30:34 AM |
| InChI | InChI=1S/C25H32N6O4/c1-5-8-18-22-23(29(4)28-18)25(34)27-24(26-22)17-13-16(9-10-20(17)35-7-3)19(32)14-30-11-12-31(6-2)21(33)15-30/h9-10,13H,5-8,11-12,14-15H2,1-4H3,(H,26,27,34) |
| InChI Key | ADYHMKHETXNXBT-UHFFFAOYSA-N |
| Canonical SMILES | CCCC1=NN(C2=C1NC(=NC2=O)C3=C(C=CC(=C3)C(=O)CN4CCN(C(=O)C4)CC)OCC)C |
| CAS | |
| Splash | |
| Other Names | 7H-Pyrazolo[4,3-d]pyrimidin-7-one, 5-{2-ethoxy-5-[2-(4-ethyl-3-oxo-1-piperazinyl)acetyl]phenyl}-1,6-dihydro-1-methyl-3-propyl- |