Systematic / IUPAC Name: 2-Methoxyxanthen-9-one
ID: Reference8631
Other Names:
2-Methoxyxanthone;
9H-Xanthen-9-one, 2-methoxy-;
Xanthen-9-one, 2-methoxy-
Formula: C14H10O3
2-Methoxy-9H-xanthen-9-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 110 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/6/2019 8:56:05 AM |
| InChI | InChI=1S/C14H10O3/c1-16-9-6-7-13-11(8-9)14(15)10-4-2-3-5-12(10)17-13/h2-8H,1H3 |
| InChI Key | DVZCOQQFPCMIPO-UHFFFAOYSA-N |
| Canonical SMILES | COC1=CC2=C(C=C1)OC3=CC=CC=C3C2=O |
| CAS | 1214206 |
| Splash | |
| Other Names |
2-Methoxyxanthone; 9H-Xanthen-9-one, 2-methoxy-; Xanthen-9-one, 2-methoxy- |