Systematic / IUPAC Name: Cyclohexyl[4-(2-thienylcarbonyl)-1-piperazinyl]methanone
ID: Reference8635
Other Names: Methanone, cyclohexyl[4-(2-thienylcarbonyl)-1-piperazinyl]-
Formula: C16H22N2O2S
[4-(Cyclohexylcarbonyl)piperazino](2-thienyl)methanone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 110 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/6/2019 9:19:59 AM |
| InChI | InChI=1S/C16H22N2O2S/c19-15(13-5-2-1-3-6-13)17-8-10-18(11-9-17)16(20)14-7-4-12-21-14/h4,7,12-13H,1-3,5-6,8-11H2 |
| InChI Key | GEKPOZYSBMLBMQ-UHFFFAOYSA-N |
| Canonical SMILES | C1CCC(CC1)C(=O)N2CCN(CC2)C(=O)C3=CC=CS3 |
| CAS | |
| Splash | |
| Other Names | Methanone, cyclohexyl[4-(2-thienylcarbonyl)-1-piperazinyl]- |