Systematic / IUPAC Name: 3-(4-Methylphenyl)-6-phenyl-1H-thieno[2,3-d]pyrimidine-2,4-dione
ID: Reference8642
Other Names: Thieno[2,3-d]pyrimidine-2,4(1H,3H)-dione, 3-(4-methylphenyl)-6-phenyl-
Formula: C19H14N2O2S
3-(4-Methylphenyl)-6-phenylthieno[2,3-d]pyrimidine-2,4(1H,3H)-dione mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 166 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/6/2019 11:06:01 AM |
| InChI | InChI=1S/C19H14N2O2S/c1-12-7-9-14(10-8-12)21-18(22)15-11-16(13-5-3-2-4-6-13)24-17(15)20-19(21)23/h2-11H,1H3,(H,20,23) |
| InChI Key | GELYFXAYKMEYIN-UHFFFAOYSA-N |
| Canonical SMILES | CC1=CC=C(C=C1)N2C(=O)C3=C(NC2=O)SC(=C3)C4=CC=CC=C4 |
| CAS | |
| Splash | |
| Other Names | Thieno[2,3-d]pyrimidine-2,4(1H,3H)-dione, 3-(4-methylphenyl)-6-phenyl- |