Systematic / IUPAC Name: 2-Methyl-7-thiophen-2-ylpyrazolo[1,5-a]pyrimidine
ID: Reference8657
Other Names: Pyrazolo[1,5-a]pyrimidine, 2-methyl-7-(2-thienyl)-
Formula: C11H9N3S
2-Methyl-7-(2-thienyl)pyrazolo[1,5-a]pyrimidine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 110 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/6/2019 12:56:37 PM |
| InChI | InChI=1S/C11H9N3S/c1-8-7-11-12-5-4-9(14(11)13-8)10-3-2-6-15-10/h2-7H,1H3 |
| InChI Key | NMBCDIVQGUULSR-UHFFFAOYSA-N |
| Canonical SMILES | CC1=NN2C(=CC=NC2=C1)C3=CC=CS3 |
| CAS | 701202417 |
| Splash | |
| Other Names | Pyrazolo[1,5-a]pyrimidine, 2-methyl-7-(2-thienyl)- |