Systematic / IUPAC Name: N-[2-Hydroxy-3-(4-methoxyphenoxy)propyl]-5-methyl-1,2-oxazole-3-carboxamide
ID: Reference8661
Other Names: 3-Isoxazolecarboxamide, N-[2-hydroxy-3-(4-methoxyphenoxy)propyl]-5-methyl-
Formula: C15H18N2O5
N-[2-Hydroxy-3-(4-methoxyphenoxy)propyl]-5-methyl-3-isoxazolecarboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 110 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/6/2019 1:04:14 PM |
| InChI | InChI=1S/C15H18N2O5/c1-10-7-14(17-22-10)15(19)16-8-11(18)9-21-13-5-3-12(20-2)4-6-13/h3-7,11,18H,8-9H2,1-2H3,(H,16,19) |
| InChI Key | YVKYZKKTOVKDBH-UHFFFAOYSA-N |
| Canonical SMILES | CC1=CC(=NO1)C(=O)NCC(COC2=CC=C(C=C2)OC)O |
| CAS | |
| Splash | |
| Other Names | 3-Isoxazolecarboxamide, N-[2-hydroxy-3-(4-methoxyphenoxy)propyl]-5-methyl- |