Systematic / IUPAC Name: 3-[(2-Ethylphenyl)methyl]-[1,3]oxazolo[4,5-b]pyridin-2-one
ID: Reference8662
Other Names:
Oxazolo[4,5-b]pyridin-2(3H)-one, 3-[(2-ethylphenyl)methyl]-;
3-[(2-Ethylphenyl)methyl]-2H,3H-pyrido[2,3-d][1,3]oxazol-2-one
Formula: C15H14N2O2
3-(2-Ethylbenzyl)[1,3]oxazolo[4,5-b]pyridin-2(3H)-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 110 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/6/2019 1:05:30 PM |
| InChI | InChI=1S/C15H14N2O2/c1-2-11-6-3-4-7-12(11)10-17-14-13(19-15(17)18)8-5-9-16-14/h3-9H,2,10H2,1H3 |
| InChI Key | XTZVKWCDGUIAAR-UHFFFAOYSA-N |
| Canonical SMILES | CCC1=CC=CC=C1CN2C3=C(C=CC=N3)OC2=O |
| CAS | |
| Splash | |
| Other Names |
Oxazolo[4,5-b]pyridin-2(3H)-one, 3-[(2-ethylphenyl)methyl]-; 3-[(2-Ethylphenyl)methyl]-2H,3H-pyrido[2,3-d][1,3]oxazol-2-one |
| PubChem | 2811801 |
| ChEMBL | CHEMBL1429462 |
| ChemSpider | 2090211 |