Systematic / IUPAC Name: 3-(3-Thiophen-2-yl-1,2,4-oxadiazol-5-yl)propanoic acid
ID: Reference8665
Other Names:
1,2,4-Oxadiazole-5-propanoic acid, 3-(2-thienyl)-;
3-(3-Thien-2-yl-1,2,4-oxadiazol-5-yl)propanoic acid;
3-(3-Thiophen-2-yl-[1,2,4]oxadiazol-5-yl)-propionic acid;
3-[3-(2-Thienyl)-1,2,4-oxadiazol-5-yl]propionic acid
Formula: C9H8N2O3S
3-[3-(2-Thienyl)-1,2,4-oxadiazol-5-yl]propanoic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 2 |
| No. of Spectra | 189 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/6/2019 1:19:21 PM |
| InChI | InChI=1S/C9H8N2O3S/c12-8(13)4-3-7-10-9(11-14-7)6-2-1-5-15-6/h1-2,5H,3-4H2,(H,12,13) |
| InChI Key | KXJGVLSBXNIPCO-UHFFFAOYSA-N |
| Canonical SMILES | C1=CSC(=C1)C2=NOC(=N2)CCC(=O)O |
| CAS | 500025296 |
| Splash | |
| Other Names |
1,2,4-Oxadiazole-5-propanoic acid, 3-(2-thienyl)-; 3-(3-Thien-2-yl-1,2,4-oxadiazol-5-yl)propanoic acid; 3-(3-Thiophen-2-yl-[1,2,4]oxadiazol-5-yl)-propionic acid; 3-[3-(2-Thienyl)-1,2,4-oxadiazol-5-yl]propionic acid |
| ChemSpider | 2089713 |
| ChEMBL | CHEMBL241768 |
| PubChem | 2811301 |