Systematic / IUPAC Name: 6-Chloro-2-[[4-methyl-5-(thiophen-3-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]-1,3-benzothiazole
ID: Reference8666
Other Names: Benzothiazole, 6-chloro-2-[[4-methyl-5-(3-thienylmethyl)-4H-1,2,4-triazol-3-yl]thio]-
Formula: C15H11ClN4S3
6-Chloro-2-{[4-methyl-5-(3-thienylmethyl)-4H-1,2,4-triazol-3-yl]sulfanyl}-1,3-benzothiazole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 110 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/6/2019 1:22:00 PM |
| InChI | InChI=1S/C15H11ClN4S3/c1-20-13(6-9-4-5-21-8-9)18-19-14(20)23-15-17-11-3-2-10(16)7-12(11)22-15/h2-5,7-8H,6H2,1H3 |
| InChI Key | SOESZISSFTVYMC-UHFFFAOYSA-N |
| Canonical SMILES | CN1C(=NN=C1SC2=NC3=C(S2)C=C(C=C3)Cl)CC4=CSC=C4 |
| CAS | |
| Splash | |
| Other Names | Benzothiazole, 6-chloro-2-[[4-methyl-5-(3-thienylmethyl)-4H-1,2,4-triazol-3-yl]thio]- |