Systematic / IUPAC Name: (2-Chlorophenyl){(2Z)-2-[(2-methoxyphenyl)imino]-4-methylene-3-thia-1-azaspiro[4.5]dec-1-yl}methanone
ID: Reference8690
Other Names: Methanone, (2-chlorophenyl)[(2Z)-2-[(2-methoxyphenyl)imino]-4-methylene-3-thia-1-azaspiro[4.5]dec-1-yl]-
Formula: C23H23ClN2O2S
(2-Chlorophenyl){2-[(2-methoxyphenyl)imino]-4-methylidene-3-thia-1-azaspiro[4.5]dec-1-yl}methanone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 110 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/8/2019 9:09:22 AM |
| InChI | InChI=1S/C23H23ClN2O2S/c1-16-23(14-8-3-9-15-23)26(21(27)17-10-4-5-11-18(17)24)22(29-16)25-19-12-6-7-13-20(19)28-2/h4-7,10-13H,1,3,8-9,14-15H2,2H3 |
| InChI Key | PXWDBPCYOPFIDX-UHFFFAOYSA-N |
| Canonical SMILES | COC1=CC=CC=C1N=C2N(C3(CCCCC3)C(=C)S2)C(=O)C4=CC=CC=C4Cl |
| CAS | |
| Splash | |
| Other Names | Methanone, (2-chlorophenyl)[(2Z)-2-[(2-methoxyphenyl)imino]-4-methylene-3-thia-1-azaspiro[4.5]dec-1-yl]- |