Systematic / IUPAC Name: 2-Benzoyl-3-chlorophenalen-1-one
ID: Reference8715
Other Names: 1H-Phenalen-1-one, 2-benzoyl-3-chloro-
Formula: C20H11ClO2
2-Benzoyl-3-chloro-1H-phenalen-1-one mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 110 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 3/8/2019 11:49:33 AM |
| InChI | InChI=1S/C20H11ClO2/c21-18-14-10-4-8-12-9-5-11-15(16(12)14)20(23)17(18)19(22)13-6-2-1-3-7-13/h1-11H |
| InChI Key | CUTDPQUHPIJCNI-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C=C1)C(=O)C2=C(C3=CC=CC4=C3C(=CC=C4)C2=O)Cl |
| CAS | |
| Splash | |
| Other Names | 1H-Phenalen-1-one, 2-benzoyl-3-chloro- |