Systematic / IUPAC Name: Phthalic acid
ID: Reference875
Other Names:
1,2-Benzenedicarboxylic acid;
Benzene-1,2-dicarboxylic acid;
o-Dicarboxybenzene;
o-Phthalic acid;
Phthals
; more
Formula: C8H6O4
Class: Industrial Chemicals
Phthalic acid mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 71 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 10/13/2016 11:46:37 AM |
| InChI | InChI=1S/C8H6O4/c9-7(10)5-3-1-2-4-6(5)8(11)12/h1-4H,(H,9,10)(H,11,12) |
| InChI Key | XNGIFLGASWRNHJ-UHFFFAOYSA-N |
| Canonical SMILES | C1=CC=C(C(=C1)C(=O)O)C(=O)O |
| CAS | 88993 |
| Splash | |
| Other Names |
1,2-Benzenedicarboxylic acid; Benzene-1,2-dicarboxylic acid; o-Dicarboxybenzene; o-Phthalic acid; Phthals; Sunftal 20; Phthalinate; Phthalinic acid; o-Carboxybenzoic acid |