Systematic / IUPAC Name: 2-[(3S)-1-Benzylpyrrolidin-3-yl]-1-methylbenzimidazole
ID: Reference8818
Other Names:
1H-Benzimidazole, 1-methyl-2-[(3S)-1-(phenylmethyl)-3-pyrrolidinyl]-;
NAT31-470390
Formula: C19H21N3
2-[(3S)-1-Benzyl-3-pyrrolidinyl]-1-methyl-1H-benzimidazole mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 450 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 8/5/2019 7:36:19 AM |
| InChI | InChI=1S/C19H21N3/c1-21-18-10-6-5-9-17(18)20-19(21)16-11-12-22(14-16)13-15-7-3-2-4-8-15/h2-10,16H,11-14H2,1H3/t16-/m0/s1 |
| InChI Key | CRTIKDCLFIPRSY-INIZCTEOSA-N |
| Canonical SMILES | |
| CAS | |
| Splash | |
| Other Names |
1H-Benzimidazole, 1-methyl-2-[(3S)-1-(phenylmethyl)-3-pyrrolidinyl]-; NAT31-470390 |