Systematic / IUPAC Name: 1-[(2R,4S,5R)-5-Ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-N-[(4-methoxyphenyl)methyl]methanamine
ID: Reference8876
Other Names: NAT13-337532
Formula: C18H26N2O
1-[(2R,4S,5R)-5-Ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-N-[(4-methoxyphenyl)methyl]methanamine mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 290 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 8/22/2019 8:22:15 AM |
| InChI | InChI=1S/C18H26N2O/c1-3-15-13-20-9-8-16(15)10-17(20)12-19-11-14-4-6-18(21-2)7-5-14/h3-7,15-17,19H,1,8-13H2,2H3/t15-,16-,17+/m0/s1 |
| InChI Key | YAJNWCWXBKISJG-UHFFFAOYSA-N |
| Canonical SMILES | COC1=CC=C(C=C1)CNCC2CC3CCN2CC3C=C |
| CAS | |
| Splash | |
| Other Names | NAT13-337532 |