Systematic / IUPAC Name: (3R,4S,6R)-N-Cyclopropyl-6-[[4-(methoxymethyl)triazol-1-yl]methyl]-1-azabicyclo[2.2.2]octane-3-carboxamide
ID: Reference8879
Other Names: NAT13-309418
Formula: C16H25N5O2
(3R,4S,6R)-N-Cyclopropyl-6-[[4-(methoxymethyl)triazol-1-yl]methyl]-1-azabicyclo[2.2.2]octane-3-carboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 999 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 8/22/2019 8:25:38 AM |
| InChI | InChI=1S/C16H25N5O2/c1-23-10-13-7-21(19-18-13)8-14-6-11-4-5-20(14)9-15(11)16(22)17-12-2-3-12/h7,11-12,14-15H,2-6,8-10H2,1H3,(H,17,22)/t11-,14+,15-/m0/s1 |
| InChI Key | DVCRKHRAVJVYCM-GLQYFDAESA-N |
| Canonical SMILES | COCC1=CN(N=N1)CC2CC3CCN2CC3C(=O)NC4CC4 |
| CAS | |
| Splash | |
| Other Names | NAT13-309418 |