Systematic / IUPAC Name: (3R,4S,6R)-N-[(4-Fluorophenyl)methyl]-6-[[4-(1-hydroxycyclopentyl)triazol-1-yl]methyl]-1-azabicyclo[2.2.2]octane-3-carboxamide
ID: Reference8884
Other Names: NAT13-329188
Formula: C23H30FN5O2
(3R,4S,6R)-N-(4-Fluorobenzyl)-6-{[4-(1-hydroxycyclopentyl)-1H-1,2,3-triazol-1-yl]methyl}quinuclidine-3-carboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 2 |
| No. of Spectra | 5628 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 5/4/2023 11:50:32 AM |
| InChI | InChI=1S/C23H30FN5O2/c24-18-5-3-16(4-6-18)12-25-22(30)20-14-28-10-7-17(20)11-19(28)13-29-15-21(26-27-29)23(31)8-1-2-9-23/h3-6,15,17,19-20,31H,1-2,7-14H2,(H,25,30)/t17-,19+,20-/m0/s1 |
| InChI Key | ZSTBMXUYQXDYKA-SXLOBPIMSA-N |
| Canonical SMILES | C1CCC(C1)(C2=CN(N=N2)CC3CC4CCN3CC4C(=O)NCC5=CC=C(C=C5)F)O |
| CAS | |
| Splash | |
| Other Names | NAT13-329188 |