Systematic / IUPAC Name: (3R,6R)-N-[(4-Fluorophenyl)methyl]-6-[[4-(4-phenylphenyl)triazol-1-yl]methyl]-1-azabicyclo[2.2.2]octane-3-carboxamide
ID: Reference8886
Other Names: NAT13-329195
Formula: C30H30FN5O
(3R,6R)-6-{[4-(4-Biphenylyl)-1H-1,2,3-triazol-1-yl]methyl}-N-(4-fluorobenzyl)quinuclidine-3-carboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 2 |
| No. of Spectra | 5280 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 6/21/2023 11:18:55 AM |
| InChI | InChI=1S/C30H30FN5O/c31-26-12-6-21(7-13-26)17-32-30(37)28-19-35-15-14-25(28)16-27(35)18-36-20-29(33-34-36)24-10-8-23(9-11-24)22-4-2-1-3-5-22/h1-13,20,25,27-28H,14-19H2,(H,32,37)/t25?,27-,28+/m1/s1 |
| InChI Key | WSBLPADHEVBYMU-INXLQGPBSA-N |
| Canonical SMILES | C1CN2CC(C1CC2CN3C=C(N=N3)C4=CC=C(C=C4)C5=CC=CC=C5)C(=O)NCC6=CC=C(C=C6)F |
| CAS | |
| Splash | |
| Other Names | NAT13-329195 |