Systematic / IUPAC Name: N-[[(2R,4S,5S)-5-Ethynyl-1-azabicyclo[2.2.2]octan-2-yl]methyl]naphthalene-2-carboxamide
ID: Reference8892
Other Names:
2-Naphthalenecarboxamide, N-[[(2R,4S,5S)-5-ethynyl-1-azabicyclo[2.2.2]oct-2-yl]methyl]-;
NAT13-337574
Formula: C21H22N2O
N-{[(2R,4S,5S)-5-Ethynyl-1-azabicyclo[2.2.2]oct-2-yl]methyl}-2-naphthamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 945 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 9/9/2019 6:19:37 AM |
| InChI | InChI=1S/C21H22N2O/c1-2-15-14-23-10-9-18(15)12-20(23)13-22-21(24)19-8-7-16-5-3-4-6-17(16)11-19/h1,3-8,11,15,18,20H,9-10,12-14H2,(H,22,24)/t15-,18-,20+/m0/s1 |
| InChI Key | YEHISLMRGVAGLN-ZAAXVRCTSA-N |
| Canonical SMILES | C#CC1CN2CCC1CC2CNC(=O)C3=CC4=CC=CC=C4C=C3 |
| CAS | |
| Splash | |
| Other Names |
2-Naphthalenecarboxamide, N-[[(2R,4S,5S)-5-ethynyl-1-azabicyclo[2.2.2]oct-2-yl]methyl]-; NAT13-337574 |