Systematic / IUPAC Name: N-(1-Amino-1-oxopropan-2-yl)-1,3,4-trihydroxy-5-[[4-(trifluoromethoxy)phenyl]carbamoylamino]cyclohexane-1-carboxamide
ID: Reference8915
Other Names:
Cyclohexanecarboxamide, N-(2-amino-1-methyl-2-oxoethyl)-1,3,4-trihydroxy-5-[[[[4-(trifluoromethoxy)phenyl]amino]carbonyl]amino]-;
NAT2-252470
Formula: C18H23F3N4O7
N-(1-Amino-1-oxo-2-propanyl)-1,3,4-trihydroxy-5-({[4-(trifluoromethoxy)phenyl]carbamoyl}amino)cyclohexanecarboxamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 2137 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 9/18/2019 12:41:14 PM |
| InChI | InChI=1S/C18H23F3N4O7/c1-8(14(22)28)23-15(29)17(31)6-11(13(27)12(26)7-17)25-16(30)24-9-2-4-10(5-3-9)32-18(19,20)21/h2-5,8,11-13,26-27,31H,6-7H2,1H3,(H2,22,28)(H,23,29)(H2,24,25,30) |
| InChI Key | NQFCUYXMAGBAEK-UHFFFAOYSA-N |
| Canonical SMILES | CC(C(=O)N)NC(=O)C1(CC(C(C(C1)O)O)NC(=O)NC2=CC=C(C=C2)OC(F)(F)F)O |
| CAS | |
| Splash | |
| Other Names |
Cyclohexanecarboxamide, N-(2-amino-1-methyl-2-oxoethyl)-1,3,4-trihydroxy-5-[[[[4-(trifluoromethoxy)phenyl]amino]carbonyl]amino]-; NAT2-252470 |