Systematic / IUPAC Name: [(3R,6R)-6-[[4-[[Benzyl(methyl)amino]methyl]triazol-1-yl]methyl]-1-azabicyclo[2.2.2]octan-3-yl]-pyrrolidin-1-ylmethanone
ID: Reference8920
Other Names: NAT13-328906
Formula: C24H34N6O
{(3R,6R)-6-[(4-{[Benzyl(methyl)amino]methyl}-1H-1,2,3-triazol-1-yl)methyl]-1-azabicyclo[2.2.2]oct-3-yl}(1-pyrrolidinyl)methanone mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 2 |
| No. of Spectra | 2750 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 6/21/2023 11:58:00 AM |
| InChI | InChI=1S/C24H34N6O/c1-27(14-19-7-3-2-4-8-19)15-21-16-30(26-25-21)17-22-13-20-9-12-29(22)18-23(20)24(31)28-10-5-6-11-28/h2-4,7-8,16,20,22-23H,5-6,9-15,17-18H2,1H3/t20?,22-,23+/m1/s1 |
| InChI Key | FJZGBUWIVLRTSI-LQKDOSGMSA-N |
| Canonical SMILES | CN(CC1=CC=CC=C1)CC2=CN(N=N2)CC3CC4CCN3CC4C(=O)N5CCCC5 |
| CAS | |
| Splash | |
| Other Names | NAT13-328906 |