Systematic / IUPAC Name: N-[[(2R,4S,5R)-5-[5-(4-Fluorophenyl)-2-methylpyrazol-3-yl]-1-azabicyclo[2.2.2]octan-2-yl]methyl]acetamide
ID: Reference8984
Other Names:
Acetamide, N-[[(2R,4S,5R)-5-[3-(4-fluorophenyl)-1-methyl-1H-pyrazol-5-yl]-1-azabicyclo[2.2.2]oct-2-yl]methyl]-;
NAT13-333886
Formula: C20H25FN4O
N-({(2R,4S,5R)-5-[3-(4-Fluorophenyl)-1-methyl-1H-pyrazol-5-yl]-1-azabicyclo[2.2.2]oct-2-yl}methyl)acetamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1674 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/14/2019 12:04:14 PM |
| InChI | InChI=1S/C20H25FN4O/c1-13(26)22-11-17-9-15-7-8-25(17)12-18(15)20-10-19(23-24(20)2)14-3-5-16(21)6-4-14/h3-6,10,15,17-18H,7-9,11-12H2,1-2H3,(H,22,26)/t15-,17+,18-/m0/s1 |
| InChI Key | KFYVBMYHYXUOGK-JQHSSLGASA-N |
| Canonical SMILES | CC(=O)NCC1CC2CCN1CC2C3=CC(=NN3C)C4=CC=C(C=C4)F |
| CAS | |
| Splash | |
| Other Names |
Acetamide, N-[[(2R,4S,5R)-5-[3-(4-fluorophenyl)-1-methyl-1H-pyrazol-5-yl]-1-azabicyclo[2.2.2]oct-2-yl]methyl]-; NAT13-333886 |