Systematic / IUPAC Name: [(2R,4S,5R)-5-[5-(3,4-Dimethoxyphenyl)-2-methylpyrazol-3-yl]-1-azabicyclo[2.2.2]octan-2-yl]methyl N-(4-acetylphenyl)carbamate
ID: Reference8985
Other Names:
Carbamic acid, N-(4-acetylphenyl)-, [(2R,4S,5R)-5-[3-(3,4-dimethoxyphenyl)-1-methyl-1H-pyrazol-5-yl]-1-azabicyclo[2.2.2]oct-2-yl]methyl ester;
NAT13-339052
Formula: C29H34N4O5
{(2R,4S,5R)-5-[3-(3,4-Dimethoxyphenyl)-1-methyl-1H-pyrazol-5-yl]-1-azabicyclo[2.2.2]oct-2-yl}methyl (4-acetylphenyl)carbamate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 864 |
| Tandem Spectra | MS1, MS2, MS3 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/14/2019 12:06:14 PM |
| InChI | InChI=1S/C29H34N4O5/c1-18(34)19-5-8-22(9-6-19)30-29(35)38-17-23-13-20-11-12-33(23)16-24(20)26-15-25(31-32(26)2)21-7-10-27(36-3)28(14-21)37-4/h5-10,14-15,20,23-24H,11-13,16-17H2,1-4H3,(H,30,35)/t20-,23+,24-/m0/s1 |
| InChI Key | YDJVUIZYVVFMTQ-ZTCOLXNVSA-N |
| Canonical SMILES | CC(=O)C1=CC=C(C=C1)NC(=O)OCC2CC3CCN2CC3C4=CC(=NN4C)C5=CC(=C(C=C5)OC)OC |
| CAS | |
| Splash | |
| Other Names |
Carbamic acid, N-(4-acetylphenyl)-, [(2R,4S,5R)-5-[3-(3,4-dimethoxyphenyl)-1-methyl-1H-pyrazol-5-yl]-1-azabicyclo[2.2.2]oct-2-yl]methyl ester; NAT13-339052 |