Systematic / IUPAC Name: 3,5-Dichloro-N-[(1-ethyl-2-pyrrolidinyl)methyl]-2-hydroxy-6-methoxybenzamide
ID: Reference901
Other Names:
Raclopride;
(-)-(S)-3,5-Dichloro-N-[(1-ethyl-2-pyrrolidinyl)methyl]-6-hydroxy-o-anisamide ;
(S)-3,5-Dichloro-N-[(1-ethylpyrrolidin-2-yl)methyl]-2-hydroxy-6-methoxybenzamide
Formula: C15H20Cl2N2O3
S-(-)-Raclopride mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Q Exactive Orbitrap |
| No. of Spectral Trees | 1 |
| No. of Spectra | 71 |
| Tandem Spectra | MS1, MS2 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 10/13/2016 12:02:45 PM |
| InChI | InChI=1S/C15H20Cl2N2O3/c1-3-19-6-4-5-9(19)8-18-15(21)12-13(20)10(16)7-11(17)14(12)22-2/h7,9,20H,3-6,8H2,1-2H3,(H,18,21)/t9-/m0/s1 |
| InChI Key | WAOQONBSWFLFPE-VIFPVBQESA-N |
| Canonical SMILES | |
| CAS | 84225956 |
| Splash | |
| Other Names |
Raclopride; (-)-(S)-3,5-Dichloro-N-[(1-ethyl-2-pyrrolidinyl)methyl]-6-hydroxy-o-anisamide ; (S)-3,5-Dichloro-N-[(1-ethylpyrrolidin-2-yl)methyl]-2-hydroxy-6-methoxybenzamide |
| ChEMBL | CHEMBL8809 |
| ChemIDPlus | 097849542 |
| Wikipedia | Raclopride |
| ChemSpider | 2298373 |
| PubChem | 3033769 |