Systematic / IUPAC Name: 1-Methyl-5-(1-oxido-3-pyridinyl)-2-pyrrolidinone
ID: Reference905
Other Names: 1-Methyl-5-(1-oxidopyridin-5-yl)pyrrolidin-2-one
Formula: C10H12N2O2
Class: Endogenous Metabolites
Cotinine N-oxide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Elite |
| No. of Spectral Trees | 1 |
| No. of Spectra | 205 |
| Tandem Spectra | MS1, MS2, MS3, MS4 |
| Ionization Methods | ESI |
| Analyzers | FT |
| Last Modification | 10/26/2015 12:08:04 PM |
| InChI | InChI=1S/C10H12N2O2/c1-11-9(4-5-10(11)13)8-3-2-6-12(14)7-8/h2-3,6-7,9H,4-5H2,1H3 |
| InChI Key | CIPULDKLIIVIER-UHFFFAOYSA-N |
| Canonical SMILES | CN1C(CCC1=O)C2=C[N+](=CC=C2)[O-] |
| CAS | 36508802 |
| Splash | |
| Other Names | 1-Methyl-5-(1-oxidopyridin-5-yl)pyrrolidin-2-one |