Systematic / IUPAC Name: N-[[(2R,4S,5R)-5-[5-(2-Methoxyphenyl)-2-methylpyrazol-3-yl]-1-azabicyclo[2.2.2]octan-2-yl]methyl]acetamide
ID: Reference9050
Other Names:
Acetamide, N-[[(2R,4S,5R)-5-[3-(2-methoxyphenyl)-1-methyl-1H-pyrazol-5-yl]-1-azabicyclo[2.2.2]oct-2-yl]methyl]-;
NAT13-333406
Formula: C21H28N4O2
N-({(2R,4S,5R)-5-[3-(2-Methoxyphenyl)-1-methyl-1H-pyrazol-5-yl]-1-azabicyclo[2.2.2]oct-2-yl}methyl)acetamide mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 1542 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 10/25/2019 11:54:55 AM |
| InChI | InChI=1S/C21H28N4O2/c1-14(26)22-12-16-10-15-8-9-25(16)13-18(15)20-11-19(23-24(20)2)17-6-4-5-7-21(17)27-3/h4-7,11,15-16,18H,8-10,12-13H2,1-3H3,(H,22,26)/t15-,16+,18-/m0/s1 |
| InChI Key | MNGJYIHESBYIPS-JZXOWHBKSA-N |
| Canonical SMILES | CC(=O)NCC1CC2CCN1CC2C3=CC(=NN3C)C4=CC=CC=C4OC |
| CAS | |
| Splash | |
| Other Names |
Acetamide, N-[[(2R,4S,5R)-5-[3-(2-methoxyphenyl)-1-methyl-1H-pyrazol-5-yl]-1-azabicyclo[2.2.2]oct-2-yl]methyl]-; NAT13-333406 |