Systematic / IUPAC Name: [(2R,4S,5R)-5-(2-Methyl-5-thiophen-2-ylpyrazol-3-yl)-1-azabicyclo[2.2.2]octan-2-yl]methyl N-propan-2-ylcarbamate
ID: Reference9060
Other Names:
Carbamic acid, N-(1-methylethyl)-, [(2R,4S,5R)-5-[1-methyl-3-(2-thienyl)-1H-pyrazol-5-yl]-1-azabicyclo[2.2.2]oct-2-yl]methyl ester;
NAT13-331655
Formula: C20H28N4O2S
{(2R,4S,5R)-5-[1-Methyl-3-(2-thienyl)-1H-pyrazol-5-yl]-1-azabicyclo[2.2.2]oct-2-yl}methyl isopropylcarbamate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 2359 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 11/4/2019 11:16:53 AM |
| InChI | InChI=1S/C20H28N4O2S/c1-13(2)21-20(25)26-12-15-9-14-6-7-24(15)11-16(14)18-10-17(22-23(18)3)19-5-4-8-27-19/h4-5,8,10,13-16H,6-7,9,11-12H2,1-3H3,(H,21,25)/t14-,15+,16-/m0/s1 |
| InChI Key | AJHJWCBMYCWYMZ-XHSDSOJGSA-N |
| Canonical SMILES | CC(C)NC(=O)OCC1CC2CCN1CC2C3=CC(=NN3C)C4=CC=CS4 |
| CAS | |
| Splash | |
| Other Names |
Carbamic acid, N-(1-methylethyl)-, [(2R,4S,5R)-5-[1-methyl-3-(2-thienyl)-1H-pyrazol-5-yl]-1-azabicyclo[2.2.2]oct-2-yl]methyl ester; NAT13-331655 |