Systematic / IUPAC Name: [(2R,4S,5R)-5-[5-(2-Methoxyphenyl)-2-methylpyrazol-3-yl]-1-azabicyclo[2.2.2]octan-2-yl]methyl N-(4-methoxyphenyl)carbamate
ID: Reference9079
Other Names:
Carbamic acid, N-(4-methoxyphenyl)-, [(2R,4S,5R)-5-[3-(2-methoxyphenyl)-1-methyl-1H-pyrazol-5-yl]-1-azabicyclo[2.2.2]oct-2-yl]methyl ester;
NAT13-331720
Formula: C27H32N4O4
{(2R,4S,5R)-5-[3-(2-Methoxyphenyl)-1-methyl-1H-pyrazol-5-yl]-1-azabicyclo[2.2.2]oct-2-yl}methyl (4-methoxyphenyl)carbamate mass spectral data can be found in a separate interface. The data are manually curated and of the highest quality.
| Used Instruments | Orbitrap Fusion Lumos with ETD LBP FAIMS |
| No. of Spectral Trees | 1 |
| No. of Spectra | 2231 |
| Tandem Spectra | MS1, MS2, MS3, MS4, MS5, MS6 |
| Ionization Methods | NSI |
| Analyzers | FT |
| Last Modification | 11/6/2019 11:22:24 AM |
| InChI | InChI=1S/C27H32N4O4/c1-30-25(15-24(29-30)22-6-4-5-7-26(22)34-3)23-16-31-13-12-18(23)14-20(31)17-35-27(32)28-19-8-10-21(33-2)11-9-19/h4-11,15,18,20,23H,12-14,16-17H2,1-3H3,(H,28,32)/t18-,20+,23-/m0/s1 |
| InChI Key | VOHRYEKMIGUKHW-NOXFTYBFSA-N |
| Canonical SMILES | CN1C(=CC(=N1)C2=CC=CC=C2OC)C3CN4CCC3CC4COC(=O)NC5=CC=C(C=C5)OC |
| CAS | |
| Splash | |
| Other Names |
Carbamic acid, N-(4-methoxyphenyl)-, [(2R,4S,5R)-5-[3-(2-methoxyphenyl)-1-methyl-1H-pyrazol-5-yl]-1-azabicyclo[2.2.2]oct-2-yl]methyl ester; NAT13-331720 |